C12H14N4O7 — CID 70673677
(2R,3S,4R,6R)-2-(hydroxymethyl)-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-3,4-diol (PubChem CID 70673677) has the molecular formula C12H14N4O7 and a molecular weight of 326.27 g/mol. Its IUPAC name is (2R,3S,4R,6R)-2-(hydroxymethyl)-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-3,4-diol.
| Compound Name | (2R,3S,4R,6R)-2-(hydroxymethyl)-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 70673677 |
| Molecular Formula | C12H14N4O7 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (2R,3S,4R,6R)-2-(hydroxymethyl)-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2C[C@@H](O)[C@H](O)[C@@H](CO)O2)c2nonc12 |
| InChI | InChI=1S/C12H14N4O7/c17-4-8-12(19)7(18)3-9(22-8)13-5-1-2-6(16(20)21)11-10(5)14-23-15-11/h1-2,7-9,12-13,17-19H,3-4H2/t7-,8-,9-,12+/m1/s1 |
| InChIKey | ZLZYRKNEBSZOAJ-HNBLOZHYSA-N |
| XLogP | -0.63 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|