C13H16N4O3 — CID 43394998
N-(4-methylcyclohexyl)-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 43394998) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-(4-methylcyclohexyl)-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 43394998 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-(4-methylcyclohexyl)-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CC1CCC(Nc2ccc([N+](=O)[O-])c3nonc23)CC1 |
| InChI | InChI=1S/C13H16N4O3/c1-8-2-4-9(5-3-8)14-10-6-7-11(17(18)19)13-12(10)15-20-16-13/h6-9,14H,2-5H2,1H3 |
| InChIKey | NMMUVAHGSXVNEH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|