C11H11N5O4 — CID 62060382
3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]piperidin-2-one (PubChem CID 62060382) has the molecular formula C11H11N5O4 and a molecular weight of 277.24 g/mol. Its IUPAC name is 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]piperidin-2-one.
| Compound Name | 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 62060382 |
| Molecular Formula | C11H11N5O4 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]piperidin-2-one |
| SMILES | O=C1NCCCC1Nc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C11H11N5O4/c17-11-7(2-1-5-12-11)13-6-3-4-8(16(18)19)10-9(6)14-20-15-10/h3-4,7,13H,1-2,5H2,(H,12,17) |
| InChIKey | GVEBKNJGQYMZQV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|