C10H8N4O6S — CID 22016136
ethyl 2-nitro-2-(4-nitro-2,1,3-benzothiadiazol-7-yl)acetate (PubChem CID 22016136) has the molecular formula C10H8N4O6S and a molecular weight of 312.26 g/mol. Its IUPAC name is ethyl 2-nitro-2-(4-nitro-2,1,3-benzothiadiazol-7-yl)acetate.
| Compound Name | ethyl 2-nitro-2-(4-nitro-2,1,3-benzothiadiazol-7-yl)acetate |
|---|---|
| PubChem CID | 22016136 |
| Molecular Formula | C10H8N4O6S |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | ethyl 2-nitro-2-(4-nitro-2,1,3-benzothiadiazol-7-yl)acetate |
| SMILES | CCOC(=O)C(c1ccc([N+](=O)[O-])c2nsnc12)[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N4O6S/c1-2-20-10(15)9(14(18)19)5-3-4-6(13(16)17)8-7(5)11-21-12-8/h3-4,9H,2H2,1H3 |
| InChIKey | PHHIYOPITVNPPJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 138.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|