C11H9N4NaO5 — CID 173183011
sodium;ethyl 2-cyano-2-(4-nitro-2,1,3-benzoxadiazol-7-yl)acetate;hydride (PubChem CID 173183011) has the molecular formula C11H9N4NaO5 and a molecular weight of 300.21 g/mol. Its IUPAC name is sodium;ethyl 2-cyano-2-(4-nitro-2,1,3-benzoxadiazol-7-yl)acetate;hydride.
| Compound Name | sodium;ethyl 2-cyano-2-(4-nitro-2,1,3-benzoxadiazol-7-yl)acetate;hydride |
|---|---|
| PubChem CID | 173183011 |
| Molecular Formula | C11H9N4NaO5 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | sodium;ethyl 2-cyano-2-(4-nitro-2,1,3-benzoxadiazol-7-yl)acetate;hydride |
| SMILES | CCOC(=O)C(C#N)c1ccc([N+](=O)[O-])c2nonc12.[H-].[Na+] |
| InChI | InChI=1S/C11H8N4O5.Na.H/c1-2-19-11(16)7(5-12)6-3-4-8(15(17)18)10-9(6)13-20-14-10;;/h3-4,7H,2H2,1H3;;/q;+1;-1 |
| InChIKey | VDXFOPNPOUSEBW-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 132.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|