C18H23N3O5 — CID 144568398
ethyl 2-cyano-2-[4-[(4,4-dimethyl-2-oxopentyl)amino]-2-nitrophenyl]acetate (PubChem CID 144568398) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is ethyl 2-cyano-2-[4-[(4,4-dimethyl-2-oxopentyl)amino]-2-nitrophenyl]acetate.
| Compound Name | ethyl 2-cyano-2-[4-[(4,4-dimethyl-2-oxopentyl)amino]-2-nitrophenyl]acetate |
|---|---|
| PubChem CID | 144568398 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | ethyl 2-cyano-2-[4-[(4,4-dimethyl-2-oxopentyl)amino]-2-nitrophenyl]acetate |
| SMILES | CCOC(=O)C(C#N)c1ccc(NCC(=O)CC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N3O5/c1-5-26-17(23)15(10-19)14-7-6-12(8-16(14)21(24)25)20-11-13(22)9-18(2,3)4/h6-8,15,20H,5,9,11H2,1-4H3 |
| InChIKey | NZWJIQDDBQRPQK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|