C11H8N4O6 — CID 22016142
ethyl 2-cyano-2-(4-nitro-3-oxido-2,1,3-benzoxadiazol-3-ium-7-yl)acetate (PubChem CID 22016142) has the molecular formula C11H8N4O6 and a molecular weight of 292.21 g/mol. Its IUPAC name is ethyl 2-cyano-2-(4-nitro-3-oxido-2,1,3-benzoxadiazol-3-ium-7-yl)acetate.
| Compound Name | ethyl 2-cyano-2-(4-nitro-3-oxido-2,1,3-benzoxadiazol-3-ium-7-yl)acetate |
|---|---|
| PubChem CID | 22016142 |
| Molecular Formula | C11H8N4O6 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | ethyl 2-cyano-2-(4-nitro-3-oxido-2,1,3-benzoxadiazol-3-ium-7-yl)acetate |
| SMILES | CCOC(=O)C(C#N)c1ccc([N+](=O)[O-])c2c1no[n+]2[O-] |
| InChI | InChI=1S/C11H8N4O6/c1-2-20-11(16)7(5-12)6-3-4-8(14(17)18)10-9(6)13-21-15(10)19/h3-4,7H,2H2,1H3 |
| InChIKey | CRSSMWHWSIMTJT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 146.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|