C12H13N3O5 — CID 124793739
ethyl (2S)-2-cyano-2-(2,6-dimethyl-4-nitro-1-oxidopyridin-1-ium-3-yl)acetate (PubChem CID 124793739) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-2-(2,6-dimethyl-4-nitro-1-oxidopyridin-1-ium-3-yl)acetate.
| Compound Name | ethyl (2S)-2-cyano-2-(2,6-dimethyl-4-nitro-1-oxidopyridin-1-ium-3-yl)acetate |
|---|---|
| PubChem CID | 124793739 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | ethyl (2S)-2-cyano-2-(2,6-dimethyl-4-nitro-1-oxidopyridin-1-ium-3-yl)acetate |
| SMILES | CCOC(=O)[C@H](C#N)c1c([N+](=O)[O-])cc(C)[n+]([O-])c1C |
| InChI | InChI=1S/C12H13N3O5/c1-4-20-12(16)9(6-13)11-8(3)14(17)7(2)5-10(11)15(18)19/h5,9H,4H2,1-3H3/t9-/m1/s1 |
| InChIKey | ITIMXKKLUHCEEG-SECBINFHSA-N |
| XLogP | 1.02 |
| TPSA | 120.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|