C13H12N4O4 — CID 22016121
4,4-dimethyl-2-(4-nitro-2,1,3-benzoxadiazol-7-yl)-3-oxopentanenitrile (PubChem CID 22016121) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4,4-dimethyl-2-(4-nitro-2,1,3-benzoxadiazol-7-yl)-3-oxopentanenitrile.
| Compound Name | 4,4-dimethyl-2-(4-nitro-2,1,3-benzoxadiazol-7-yl)-3-oxopentanenitrile |
|---|---|
| PubChem CID | 22016121 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4,4-dimethyl-2-(4-nitro-2,1,3-benzoxadiazol-7-yl)-3-oxopentanenitrile |
| SMILES | CC(C)(C)C(=O)C(C#N)c1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C13H12N4O4/c1-13(2,3)12(18)8(6-14)7-4-5-9(17(19)20)11-10(7)15-21-16-11/h4-5,8H,1-3H3 |
| InChIKey | NSFKTHWKNLMILL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 122.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|