sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate

C11H10N2NaO5+ — CID 70160824

IUPACsodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate
SMILESCOC(=O)C(C#N)c1ccc(OC)cc1[N+](=O)[O-].[Na+]
InChIInChI=1S/C11H10N2O5.Na/c1-17-7-3-4-8(10(5-7)13(15)16)9(6-12)11(14)18-2;/h3-5,9H,1-2H3;/q;+1
InChIKeyLVWZXFFEWGAVIE-UHFFFAOYSA-N
MW273.20 g/mol
LogP-1.61
Rot. Bonds4

About sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate

sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate (PubChem CID 70160824) has the molecular formula C11H10N2NaO5+ and a molecular weight of 273.20 g/mol. Its IUPAC name is sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate.

Molecular Properties

Compound Namesodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate
PubChem CID70160824
Molecular FormulaC11H10N2NaO5+
Molecular Weight273.20 g/mol
Exact Mass273.05
IUPAC Namesodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate
SMILESCOC(=O)C(C#N)c1ccc(OC)cc1[N+](=O)[O-].[Na+]
InChIInChI=1S/C11H10N2O5.Na/c1-17-7-3-4-8(10(5-7)13(15)16)9(6-12)11(14)18-2;/h3-5,9H,1-2H3;/q;+1
InChIKeyLVWZXFFEWGAVIE-UHFFFAOYSA-N
XLogP-1.61
TPSA102.46 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.20
LogP ≤ 5-1.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate?
The IUPAC name of sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate (CID 70160824) is sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate.
What is the SMILES notation for sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate?
The canonical SMILES for sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate is COC(=O)C(C#N)c1ccc(OC)cc1[N+](=O)[O-].[Na+].
What is the InChIKey of sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate?
The InChIKey is LVWZXFFEWGAVIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O5.Na/c1-17-7-3-4-8(10(5-7)13(15)16)9(6-12)11(14)18-2;/h3-5,9H,1-2H3;/q;+1.
What are the key properties of sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate?
sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate has a molecular weight of 273.20 g/mol, XLogP of -1.61, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium methyl 2-cyano-2-(4-methoxy-2-nitrophenyl)acetate is sourced from PubChem (CID 70160824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).