C14H21NO2S — CID 20504774
2,6-bis(2-methylpropyl)-3-nitrobenzenethiol (PubChem CID 20504774) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2,6-bis(2-methylpropyl)-3-nitrobenzenethiol.
| Compound Name | 2,6-bis(2-methylpropyl)-3-nitrobenzenethiol |
|---|---|
| PubChem CID | 20504774 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2,6-bis(2-methylpropyl)-3-nitrobenzenethiol |
| SMILES | CC(C)Cc1ccc([N+](=O)[O-])c(CC(C)C)c1S |
| InChI | InChI=1S/C14H21NO2S/c1-9(2)7-11-5-6-13(15(16)17)12(14(11)18)8-10(3)4/h5-6,9-10,18H,7-8H2,1-4H3 |
| InChIKey | OHNOLSWEJCDIQT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|