C13H9N3O3S2 — CID 155694575
4-(4-methoxyphenyl)sulfanyl-7-nitro-2,1,3-benzothiadiazole (PubChem CID 155694575) has the molecular formula C13H9N3O3S2 and a molecular weight of 319.37 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfanyl-7-nitro-2,1,3-benzothiadiazole.
| Compound Name | 4-(4-methoxyphenyl)sulfanyl-7-nitro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 155694575 |
| Molecular Formula | C13H9N3O3S2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfanyl-7-nitro-2,1,3-benzothiadiazole |
| SMILES | COc1ccc(Sc2ccc([N+](=O)[O-])c3nsnc23)cc1 |
| InChI | InChI=1S/C13H9N3O3S2/c1-19-8-2-4-9(5-3-8)20-11-7-6-10(16(17)18)12-13(11)15-21-14-12/h2-7H,1H3 |
| InChIKey | LFSRBABQCGHASS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|