C14H7N5NaO4S+ — CID 22508232
sodium 2-(4-nitro-2,1,3-benzothiadiazol-7-yl)-2-(2-nitrophenyl)acetonitrile (PubChem CID 22508232) has the molecular formula C14H7N5NaO4S+ and a molecular weight of 364.30 g/mol. Its IUPAC name is sodium 2-(4-nitro-2,1,3-benzothiadiazol-7-yl)-2-(2-nitrophenyl)acetonitrile.
| Compound Name | sodium 2-(4-nitro-2,1,3-benzothiadiazol-7-yl)-2-(2-nitrophenyl)acetonitrile |
|---|---|
| PubChem CID | 22508232 |
| Molecular Formula | C14H7N5NaO4S+ |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | sodium 2-(4-nitro-2,1,3-benzothiadiazol-7-yl)-2-(2-nitrophenyl)acetonitrile |
| SMILES | N#CC(c1ccccc1[N+](=O)[O-])c1ccc([N+](=O)[O-])c2nsnc12.[Na+] |
| InChI | InChI=1S/C14H7N5O4S.Na/c15-7-10(8-3-1-2-4-11(8)18(20)21)9-5-6-12(19(22)23)14-13(9)16-24-17-14;/h1-6,10H;/q;+1 |
| InChIKey | QNTIJLVKRVNVKC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 135.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|