C7H7N5O2 — CID 137243204
7-nitro-3H-benzimidazole-2,4-diamine (PubChem CID 137243204) has the molecular formula C7H7N5O2 and a molecular weight of 193.17 g/mol. Its IUPAC name is 7-nitro-3H-benzimidazole-2,4-diamine.
| Compound Name | 7-nitro-3H-benzimidazole-2,4-diamine |
|---|---|
| PubChem CID | 137243204 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 7-nitro-3H-benzimidazole-2,4-diamine |
| SMILES | Nc1nc2c([N+](=O)[O-])ccc(N)c2[nH]1 |
| InChI | InChI=1S/C7H7N5O2/c8-3-1-2-4(12(13)14)6-5(3)10-7(9)11-6/h1-2H,8H2,(H3,9,10,11) |
| InChIKey | JNYXOCPZOSSXLV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|