C8H10N4O — CID 130849289
7-methoxy-1H-benzimidazole-2,4-diamine (PubChem CID 130849289) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 7-methoxy-1H-benzimidazole-2,4-diamine.
| Compound Name | 7-methoxy-1H-benzimidazole-2,4-diamine |
|---|---|
| PubChem CID | 130849289 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 7-methoxy-1H-benzimidazole-2,4-diamine |
| SMILES | COc1ccc(N)c2nc(N)[nH]c12 |
| InChI | InChI=1S/C8H10N4O/c1-13-5-3-2-4(9)6-7(5)12-8(10)11-6/h2-3H,9H2,1H3,(H3,10,11,12) |
| InChIKey | JKDIUINMBVADGI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|