C8H9BrN4 — CID 130780242
7-(bromomethyl)-3H-benzimidazole-2,4-diamine (PubChem CID 130780242) has the molecular formula C8H9BrN4 and a molecular weight of 241.09 g/mol. Its IUPAC name is 7-(bromomethyl)-3H-benzimidazole-2,4-diamine.
| Compound Name | 7-(bromomethyl)-3H-benzimidazole-2,4-diamine |
|---|---|
| PubChem CID | 130780242 |
| Molecular Formula | C8H9BrN4 |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 7-(bromomethyl)-3H-benzimidazole-2,4-diamine |
| SMILES | Nc1nc2c(CBr)ccc(N)c2[nH]1 |
| InChI | InChI=1S/C8H9BrN4/c9-3-4-1-2-5(10)7-6(4)12-8(11)13-7/h1-2H,3,10H2,(H3,11,12,13) |
| InChIKey | MCCUCFUQBJLQHV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|