C8H9ClN4 — CID 131080307
4-(chloromethyl)-1H-benzimidazole-2,5-diamine (PubChem CID 131080307) has the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. Its IUPAC name is 4-(chloromethyl)-1H-benzimidazole-2,5-diamine.
| Compound Name | 4-(chloromethyl)-1H-benzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 131080307 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 4-(chloromethyl)-1H-benzimidazole-2,5-diamine |
| SMILES | Nc1nc2c(CCl)c(N)ccc2[nH]1 |
| InChI | InChI=1S/C8H9ClN4/c9-3-4-5(10)1-2-6-7(4)13-8(11)12-6/h1-2H,3,10H2,(H3,11,12,13) |
| InChIKey | VCVMPMWEQGTBJV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|