C20H17N9O2 — CID 136678251
2-[N-(1-cyanoethyl)-4-[[5-(4-nitrophenyl)-1H-1,2,4-triazol-3-yl]diazenyl]anilino]propanenitrile (PubChem CID 136678251) has the molecular formula C20H17N9O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 2-[N-(1-cyanoethyl)-4-[[5-(4-nitrophenyl)-1H-1,2,4-triazol-3-yl]diazenyl]anilino]propanenitrile.
| Compound Name | 2-[N-(1-cyanoethyl)-4-[[5-(4-nitrophenyl)-1H-1,2,4-triazol-3-yl]diazenyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 136678251 |
| Molecular Formula | C20H17N9O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[N-(1-cyanoethyl)-4-[[5-(4-nitrophenyl)-1H-1,2,4-triazol-3-yl]diazenyl]anilino]propanenitrile |
| SMILES | CC(C#N)N(c1ccc(/N=N/c2n[nH]c(-c3ccc([N+](=O)[O-])cc3)n2)cc1)C(C)C#N |
| InChI | InChI=1S/C20H17N9O2/c1-13(11-21)28(14(2)12-22)17-9-5-16(6-10-17)24-26-20-23-19(25-27-20)15-3-7-18(8-4-15)29(30)31/h3-10,13-14H,1-2H3,(H,23,25,27)/b26-24+ |
| InChIKey | WSERLBVNZDLJBI-SHHOIMCASA-N |
| XLogP | 4.43 |
| TPSA | 160.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|