About (2R)-2-azido-3,3-dimethyl-1-nitrobutane
(2R)-2-azido-3,3-dimethyl-1-nitrobutane (PubChem CID 122382472) has the molecular formula C6H12N4O2
and a molecular weight of 172.19 g/mol. Its IUPAC name is (2R)-2-azido-3,3-dimethyl-1-nitrobutane.
Molecular Properties
| Compound Name | (2R)-2-azido-3,3-dimethyl-1-nitrobutane |
| PubChem CID | 122382472 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (2R)-2-azido-3,3-dimethyl-1-nitrobutane |
| SMILES | CC(C)(C)[C@H](C[N+](=O)[O-])N=[N+]=[N-] |
| InChI | InChI=1S/C6H12N4O2/c1-6(2,3)5(8-9-7)4-10(11)12/h5H,4H2,1-3H3/t5-/m0/s1 |
| InChIKey | FVVUJCOPAOLHDX-YFKPBYRVSA-N |
| XLogP | 1.99 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-azido-3,3-dimethyl-1-nitrobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-azido-3,3-dimethyl-1-nitrobutane?
The IUPAC name of (2R)-2-azido-3,3-dimethyl-1-nitrobutane (CID 122382472) is (2R)-2-azido-3,3-dimethyl-1-nitrobutane.
What is the SMILES notation for (2R)-2-azido-3,3-dimethyl-1-nitrobutane?
The canonical SMILES for (2R)-2-azido-3,3-dimethyl-1-nitrobutane is CC(C)(C)[C@H](C[N+](=O)[O-])N=[N+]=[N-].
What is the InChIKey of (2R)-2-azido-3,3-dimethyl-1-nitrobutane?
The InChIKey is FVVUJCOPAOLHDX-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H12N4O2/c1-6(2,3)5(8-9-7)4-10(11)12/h5H,4H2,1-3H3/t5-/m0/s1.
What are the key properties of (2R)-2-azido-3,3-dimethyl-1-nitrobutane?
(2R)-2-azido-3,3-dimethyl-1-nitrobutane has a molecular weight of 172.19 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-azido-3,3-dimethyl-1-nitrobutane is sourced from PubChem (CID 122382472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).