C6H8N14O4 — CID 141353088
1,1,4-triazido-2-(azidomethyl)-3-methyl-2,3-dinitrobutane (PubChem CID 141353088) has the molecular formula C6H8N14O4 and a molecular weight of 340.22 g/mol. Its IUPAC name is 1,1,4-triazido-2-(azidomethyl)-3-methyl-2,3-dinitrobutane.
| Compound Name | 1,1,4-triazido-2-(azidomethyl)-3-methyl-2,3-dinitrobutane |
|---|---|
| PubChem CID | 141353088 |
| Molecular Formula | C6H8N14O4 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1,1,4-triazido-2-(azidomethyl)-3-methyl-2,3-dinitrobutane |
| SMILES | CC(CN=[N+]=[N-])([N+](=O)[O-])C(CN=[N+]=[N-])(C(N=[N+]=[N-])N=[N+]=[N-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H8N14O4/c1-5(19(21)22,2-11-15-7)6(20(23)24,3-12-16-8)4(13-17-9)14-18-10/h4H,2-3H2,1H3 |
| InChIKey | OIWWEMKMUNOYCX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 281.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|