C25H36N8O12 — CID 4311977
ditert-butyl 2-[4-azido-6-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-1,3,5-triazin-2-yl]-2-nitropropanedioate (PubChem CID 4311977) has the molecular formula C25H36N8O12 and a molecular weight of 640.61 g/mol. Its IUPAC name is ditert-butyl 2-[4-azido-6-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-1,3,5-triazin-2-yl]-2-nitropropanedioate.
| Compound Name | ditert-butyl 2-[4-azido-6-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-1,3,5-triazin-2-yl]-2-nitropropanedioate |
|---|---|
| PubChem CID | 4311977 |
| Molecular Formula | C25H36N8O12 |
| Molecular Weight | 640.61 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | ditert-butyl 2-[4-azido-6-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-1,3,5-triazin-2-yl]-2-nitropropanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)(c1nc(N=[N+]=[N-])nc(C(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)[N+](=O)[O-])n1)[N+](=O)[O-] |
| InChI | InChI=1S/C25H36N8O12/c1-20(2,3)42-15(34)24(32(38)39,16(35)43-21(4,5)6)13-27-14(29-19(28-13)30-31-26)25(33(40)41,17(36)44-22(7,8)9)18(37)45-23(10,11)12/h1-12H3 |
| InChIKey | AXHSUUYMAQUSNA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 278.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|