C13H17N3O2 — CID 129132973
tert-butyl 6-azido-2,3-dimethylbenzoate (PubChem CID 129132973) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is tert-butyl 6-azido-2,3-dimethylbenzoate.
| Compound Name | tert-butyl 6-azido-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 129132973 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | tert-butyl 6-azido-2,3-dimethylbenzoate |
| SMILES | Cc1ccc(N=[N+]=[N-])c(C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C13H17N3O2/c1-8-6-7-10(15-16-14)11(9(8)2)12(17)18-13(3,4)5/h6-7H,1-5H3 |
| InChIKey | GRQFOYJZOJABGG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|