C10H17NO4 — CID 10846339
tert-butyl (2S)-2-methyl-2-nitropent-4-enoate (PubChem CID 10846339) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is tert-butyl (2S)-2-methyl-2-nitropent-4-enoate.
| Compound Name | tert-butyl (2S)-2-methyl-2-nitropent-4-enoate |
|---|---|
| PubChem CID | 10846339 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | tert-butyl (2S)-2-methyl-2-nitropent-4-enoate |
| SMILES | C=CC[C@@](C)(C(=O)OC(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C10H17NO4/c1-6-7-10(5,11(13)14)8(12)15-9(2,3)4/h6H,1,7H2,2-5H3/t10-/m0/s1 |
| InChIKey | NYDCOCGFKIOISP-JTQLQIEISA-N |
| XLogP | 1.94 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|