C24H30N6O18 — CID 3094627
diethyl 2-[4,6-bis(1,3-diethoxy-2-nitro-1,3-dioxopropan-2-yl)-1,3,5-triazin-2-yl]-2-nitropropanedioate (PubChem CID 3094627) has the molecular formula C24H30N6O18 and a molecular weight of 690.53 g/mol. Its IUPAC name is diethyl 2-[4,6-bis(1,3-diethoxy-2-nitro-1,3-dioxopropan-2-yl)-1,3,5-triazin-2-yl]-2-nitropropanedioate.
| Compound Name | diethyl 2-[4,6-bis(1,3-diethoxy-2-nitro-1,3-dioxopropan-2-yl)-1,3,5-triazin-2-yl]-2-nitropropanedioate |
|---|---|
| PubChem CID | 3094627 |
| Molecular Formula | C24H30N6O18 |
| Molecular Weight | 690.53 g/mol |
| Exact Mass | 690.16 |
| IUPAC Name | diethyl 2-[4,6-bis(1,3-diethoxy-2-nitro-1,3-dioxopropan-2-yl)-1,3,5-triazin-2-yl]-2-nitropropanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)(c1nc(C(C(=O)OCC)(C(=O)OCC)[N+](=O)[O-])nc(C(C(=O)OCC)(C(=O)OCC)[N+](=O)[O-])n1)[N+](=O)[O-] |
| InChI | InChI=1S/C24H30N6O18/c1-7-43-16(31)22(28(37)38,17(32)44-8-2)13-25-14(23(29(39)40,18(33)45-9-3)19(34)46-10-4)27-15(26-13)24(30(41)42,20(35)47-11-5)21(36)48-12-6/h7-12H2,1-6H3 |
| InChIKey | XFUATQVIEMKDAX-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 325.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.53 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|