About 1,5-diazido-2-nitropentane
1,5-diazido-2-nitropentane (PubChem CID 122400902) has the molecular formula C5H9N7O2
and a molecular weight of 199.17 g/mol. Its IUPAC name is 1,5-diazido-2-nitropentane.
Molecular Properties
| Compound Name | 1,5-diazido-2-nitropentane |
| PubChem CID | 122400902 |
| Molecular Formula | C5H9N7O2 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1,5-diazido-2-nitropentane |
| SMILES | [N-]=[N+]=NCCCC(CN=[N+]=[N-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H9N7O2/c6-10-8-3-1-2-5(12(13)14)4-9-11-7/h5H,1-4H2 |
| InChIKey | ZCNKJTRIXBJFSX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 140.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 1,5-diazido-2-nitropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diazido-2-nitropentane?
The IUPAC name of 1,5-diazido-2-nitropentane (CID 122400902) is 1,5-diazido-2-nitropentane.
What is the SMILES notation for 1,5-diazido-2-nitropentane?
The canonical SMILES for 1,5-diazido-2-nitropentane is [N-]=[N+]=NCCCC(CN=[N+]=[N-])[N+](=O)[O-].
What is the InChIKey of 1,5-diazido-2-nitropentane?
The InChIKey is ZCNKJTRIXBJFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N7O2/c6-10-8-3-1-2-5(12(13)14)4-9-11-7/h5H,1-4H2.
What are the key properties of 1,5-diazido-2-nitropentane?
1,5-diazido-2-nitropentane has a molecular weight of 199.17 g/mol, XLogP of 2.03, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diazido-2-nitropentane is sourced from PubChem (CID 122400902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).