About 1-azidobutane;N-ethylnitramide
1-azidobutane;N-ethylnitramide (PubChem CID 175078003) has the molecular formula C6H15N5O2
and a molecular weight of 189.22 g/mol. Its IUPAC name is 1-azidobutane;N-ethylnitramide.
Molecular Properties
| Compound Name | 1-azidobutane;N-ethylnitramide |
| PubChem CID | 175078003 |
| Molecular Formula | C6H15N5O2 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-azidobutane;N-ethylnitramide |
| SMILES | CCCCN=[N+]=[N-].CCN[N+](=O)[O-] |
| InChI | InChI=1S/C4H9N3.C2H6N2O2/c1-2-3-4-6-7-5;1-2-3-4(5)6/h2-4H2,1H3;3H,2H2,1H3 |
| InChIKey | JQDZMLUBWCRHLH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 1-azidobutane;N-ethylnitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidobutane;N-ethylnitramide?
The IUPAC name of 1-azidobutane;N-ethylnitramide (CID 175078003) is 1-azidobutane;N-ethylnitramide.
What is the SMILES notation for 1-azidobutane;N-ethylnitramide?
The canonical SMILES for 1-azidobutane;N-ethylnitramide is CCCCN=[N+]=[N-].CCN[N+](=O)[O-].
What is the InChIKey of 1-azidobutane;N-ethylnitramide?
The InChIKey is JQDZMLUBWCRHLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3.C2H6N2O2/c1-2-3-4-6-7-5;1-2-3-4(5)6/h2-4H2,1H3;3H,2H2,1H3.
What are the key properties of 1-azidobutane;N-ethylnitramide?
1-azidobutane;N-ethylnitramide has a molecular weight of 189.22 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidobutane;N-ethylnitramide is sourced from PubChem (CID 175078003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).