C2HN11O4 — CID 177383599
1,1,1-triazido-2,2-dinitroethane (PubChem CID 177383599) has the molecular formula C2HN11O4 and a molecular weight of 243.10 g/mol. Its IUPAC name is 1,1,1-triazido-2,2-dinitroethane.
| Compound Name | 1,1,1-triazido-2,2-dinitroethane |
|---|---|
| PubChem CID | 177383599 |
| Molecular Formula | C2HN11O4 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 1,1,1-triazido-2,2-dinitroethane |
| SMILES | [N-]=[N+]=NC(N=[N+]=[N-])(N=[N+]=[N-])C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C2HN11O4/c3-9-6-2(7-10-4,8-11-5)1(12(14)15)13(16)17/h1H |
| InChIKey | OWIQOKUEELUEAH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 232.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|