C5H7FN8O5 — CID 20530981
1,3-diazido-1-(1,1-dinitroethoxy)-3-fluoropropane (PubChem CID 20530981) has the molecular formula C5H7FN8O5 and a molecular weight of 278.16 g/mol. Its IUPAC name is 1,3-diazido-1-(1,1-dinitroethoxy)-3-fluoropropane.
| Compound Name | 1,3-diazido-1-(1,1-dinitroethoxy)-3-fluoropropane |
|---|---|
| PubChem CID | 20530981 |
| Molecular Formula | C5H7FN8O5 |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 1,3-diazido-1-(1,1-dinitroethoxy)-3-fluoropropane |
| SMILES | CC(OC(CC(F)N=[N+]=[N-])N=[N+]=[N-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H7FN8O5/c1-5(13(15)16,14(17)18)19-4(10-12-8)2-3(6)9-11-7/h3-4H,2H2,1H3 |
| InChIKey | FGKATDHSBVXYRI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 193.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|