C10H21NO3 — CID 10631984
2-butan-2-yloxy-3,3-dimethyl-1-nitrobutane (PubChem CID 10631984) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-butan-2-yloxy-3,3-dimethyl-1-nitrobutane.
| Compound Name | 2-butan-2-yloxy-3,3-dimethyl-1-nitrobutane |
|---|---|
| PubChem CID | 10631984 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2-butan-2-yloxy-3,3-dimethyl-1-nitrobutane |
| SMILES | CCC(C)OC(C[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C10H21NO3/c1-6-8(2)14-9(7-11(12)13)10(3,4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | NVFQWWUNUJCQHK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|