C8H16N2O6 — CID 71394407
2,3-diethoxy-1,4-dinitrobutane (PubChem CID 71394407) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is 2,3-diethoxy-1,4-dinitrobutane.
| Compound Name | 2,3-diethoxy-1,4-dinitrobutane |
|---|---|
| PubChem CID | 71394407 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2,3-diethoxy-1,4-dinitrobutane |
| SMILES | CCOC(C[N+](=O)[O-])C(C[N+](=O)[O-])OCC |
| InChI | InChI=1S/C8H16N2O6/c1-3-15-7(5-9(11)12)8(16-4-2)6-10(13)14/h7-8H,3-6H2,1-2H3 |
| InChIKey | HAIHNAXJZXIBQV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|