C13H25NO8 — CID 88750115
2-(nitromethyl)-1,4,7,10,13,16-hexaoxacyclooctadecane (PubChem CID 88750115) has the molecular formula C13H25NO8 and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-(nitromethyl)-1,4,7,10,13,16-hexaoxacyclooctadecane.
| Compound Name | 2-(nitromethyl)-1,4,7,10,13,16-hexaoxacyclooctadecane |
|---|---|
| PubChem CID | 88750115 |
| Molecular Formula | C13H25NO8 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-(nitromethyl)-1,4,7,10,13,16-hexaoxacyclooctadecane |
| SMILES | O=[N+]([O-])CC1COCCOCCOCCOCCOCCO1 |
| InChI | InChI=1S/C13H25NO8/c15-14(16)11-13-12-21-8-7-19-4-3-17-1-2-18-5-6-20-9-10-22-13/h13H,1-12H2 |
| InChIKey | PXYRCVQUMXDVKT-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|