C17H36O — CID 150049525
3-butan-2-yloxy-2,2-dimethylundecane (PubChem CID 150049525) has the molecular formula C17H36O and a molecular weight of 256.47 g/mol. Its IUPAC name is 3-butan-2-yloxy-2,2-dimethylundecane.
| Compound Name | 3-butan-2-yloxy-2,2-dimethylundecane |
|---|---|
| PubChem CID | 150049525 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | 3-butan-2-yloxy-2,2-dimethylundecane |
| SMILES | CCCCCCCCC(OC(C)CC)C(C)(C)C |
| InChI | InChI=1S/C17H36O/c1-7-9-10-11-12-13-14-16(17(4,5)6)18-15(3)8-2/h15-16H,7-14H2,1-6H3 |
| InChIKey | DKZUTMMMBKGLEH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|