C20H42O2 — CID 175062921
3-(2,2-dimethyloctan-3-ylperoxy)-2,2-dimethyloctane (PubChem CID 175062921) has the molecular formula C20H42O2 and a molecular weight of 314.55 g/mol. Its IUPAC name is 3-(2,2-dimethyloctan-3-ylperoxy)-2,2-dimethyloctane.
| Compound Name | 3-(2,2-dimethyloctan-3-ylperoxy)-2,2-dimethyloctane |
|---|---|
| PubChem CID | 175062921 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | 3-(2,2-dimethyloctan-3-ylperoxy)-2,2-dimethyloctane |
| SMILES | CCCCCC(OOC(CCCCC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H42O2/c1-9-11-13-15-17(19(3,4)5)21-22-18(20(6,7)8)16-14-12-10-2/h17-18H,9-16H2,1-8H3 |
| InChIKey | OLZRLLPRFBAYCK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|