C34H70O2 — CID 150462473
2,2,12,12-tetramethyl-3-(2,2,12,12-tetramethyltridecan-3-ylperoxy)tridecane (PubChem CID 150462473) has the molecular formula C34H70O2 and a molecular weight of 510.93 g/mol. Its IUPAC name is 2,2,12,12-tetramethyl-3-(2,2,12,12-tetramethyltridecan-3-ylperoxy)tridecane.
| Compound Name | 2,2,12,12-tetramethyl-3-(2,2,12,12-tetramethyltridecan-3-ylperoxy)tridecane |
|---|---|
| PubChem CID | 150462473 |
| Molecular Formula | C34H70O2 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.54 |
| IUPAC Name | 2,2,12,12-tetramethyl-3-(2,2,12,12-tetramethyltridecan-3-ylperoxy)tridecane |
| SMILES | CC(C)(C)CCCCCCCCC(OOC(CCCCCCCCC(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C34H70O2/c1-31(2,3)27-23-19-15-13-17-21-25-29(33(7,8)9)35-36-30(34(10,11)12)26-22-18-14-16-20-24-28-32(4,5)6/h29-30H,13-28H2,1-12H3 |
| InChIKey | HQBMBEWSVWEJIP-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|