C14H30S — CID 155176298
2,2,9,9-tetramethyldecane-3-thiol (PubChem CID 155176298) has the molecular formula C14H30S and a molecular weight of 230.46 g/mol. Its IUPAC name is 2,2,9,9-tetramethyldecane-3-thiol.
| Compound Name | 2,2,9,9-tetramethyldecane-3-thiol |
|---|---|
| PubChem CID | 155176298 |
| Molecular Formula | C14H30S |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 2,2,9,9-tetramethyldecane-3-thiol |
| SMILES | CC(C)(C)CCCCCC(S)C(C)(C)C |
| InChI | InChI=1S/C14H30S/c1-13(2,3)11-9-7-8-10-12(15)14(4,5)6/h12,15H,7-11H2,1-6H3 |
| InChIKey | BTGCBWNNLQJTBJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|