C14H27F3 — CID 89223709
1,1,1-trifluoro-2,10,10-trimethylundecane (PubChem CID 89223709) has the molecular formula C14H27F3 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,10,10-trimethylundecane.
| Compound Name | 1,1,1-trifluoro-2,10,10-trimethylundecane |
|---|---|
| PubChem CID | 89223709 |
| Molecular Formula | C14H27F3 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 1,1,1-trifluoro-2,10,10-trimethylundecane |
| SMILES | CC(CCCCCCCC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H27F3/c1-12(14(15,16)17)10-8-6-5-7-9-11-13(2,3)4/h12H,5-11H2,1-4H3 |
| InChIKey | NEHPWGLWYGPAPD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|