C27H56O2 — CID 152569510
9,13-dimethoxy-10,10,12,12-tetramethylhenicosane (PubChem CID 152569510) has the molecular formula C27H56O2 and a molecular weight of 412.74 g/mol. Its IUPAC name is 9,13-dimethoxy-10,10,12,12-tetramethylhenicosane.
| Compound Name | 9,13-dimethoxy-10,10,12,12-tetramethylhenicosane |
|---|---|
| PubChem CID | 152569510 |
| Molecular Formula | C27H56O2 |
| Molecular Weight | 412.74 g/mol |
| Exact Mass | 412.43 |
| IUPAC Name | 9,13-dimethoxy-10,10,12,12-tetramethylhenicosane |
| SMILES | CCCCCCCCC(OC)C(C)(C)CC(C)(C)C(CCCCCCCC)OC |
| InChI | InChI=1S/C27H56O2/c1-9-11-13-15-17-19-21-24(28-7)26(3,4)23-27(5,6)25(29-8)22-20-18-16-14-12-10-2/h24-25H,9-23H2,1-8H3 |
| InChIKey | YREOAYSGOMPSSL-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.74 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|