C33H70O7 — CID 159659931
1,1,1,2-tetramethoxydecane;4-(triethoxymethyl)dodecane (PubChem CID 159659931) has the molecular formula C33H70O7 and a molecular weight of 578.92 g/mol. Its IUPAC name is 1,1,1,2-tetramethoxydecane;4-(triethoxymethyl)dodecane.
| Compound Name | 1,1,1,2-tetramethoxydecane;4-(triethoxymethyl)dodecane |
|---|---|
| PubChem CID | 159659931 |
| Molecular Formula | C33H70O7 |
| Molecular Weight | 578.92 g/mol |
| Exact Mass | 578.51 |
| IUPAC Name | 1,1,1,2-tetramethoxydecane;4-(triethoxymethyl)dodecane |
| SMILES | CCCCCCCCC(CCC)C(OCC)(OCC)OCC.CCCCCCCCC(OC)C(OC)(OC)OC |
| InChI | InChI=1S/C19H40O3.C14H30O4/c1-6-11-12-13-14-15-17-18(16-7-2)19(20-8-3,21-9-4)22-10-5;1-6-7-8-9-10-11-12-13(15-2)14(16-3,17-4)18-5/h18H,6-17H2,1-5H3;13H,6-12H2,1-5H3 |
| InChIKey | MSRAOAQWXVBSOU-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.92 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|