C30H65NO6 — CID 159305061
4-(1,1-dimethoxyethyl)dodecan-1-amine;1,1,1,2-tetramethoxydecane (PubChem CID 159305061) has the molecular formula C30H65NO6 and a molecular weight of 535.85 g/mol. Its IUPAC name is 4-(1,1-dimethoxyethyl)dodecan-1-amine;1,1,1,2-tetramethoxydecane.
| Compound Name | 4-(1,1-dimethoxyethyl)dodecan-1-amine;1,1,1,2-tetramethoxydecane |
|---|---|
| PubChem CID | 159305061 |
| Molecular Formula | C30H65NO6 |
| Molecular Weight | 535.85 g/mol |
| Exact Mass | 535.48 |
| IUPAC Name | 4-(1,1-dimethoxyethyl)dodecan-1-amine;1,1,1,2-tetramethoxydecane |
| SMILES | CCCCCCCCC(CCCN)C(C)(OC)OC.CCCCCCCCC(OC)C(OC)(OC)OC |
| InChI | InChI=1S/C16H35NO2.C14H30O4/c1-5-6-7-8-9-10-12-15(13-11-14-17)16(2,18-3)19-4;1-6-7-8-9-10-11-12-13(15-2)14(16-3,17-4)18-5/h15H,5-14,17H2,1-4H3;13H,6-12H2,1-5H3 |
| InChIKey | LBUVGYHLJSNSDR-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.85 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|