About 2,3-dimethylbutane;3-methylundecane
2,3-dimethylbutane;3-methylundecane (PubChem CID 173307544) has the molecular formula C18H40
and a molecular weight of 256.52 g/mol. Its IUPAC name is 2,3-dimethylbutane;3-methylundecane.
Molecular Properties
| Compound Name | 2,3-dimethylbutane;3-methylundecane |
| PubChem CID | 173307544 |
| Molecular Formula | C18H40 |
| Molecular Weight | 256.52 g/mol |
| Exact Mass | 256.31 |
| IUPAC Name | 2,3-dimethylbutane;3-methylundecane |
| SMILES | CC(C)C(C)C.CCCCCCCCC(C)CC |
| InChI | InChI=1S/C12H26.C6H14/c1-4-6-7-8-9-10-11-12(3)5-2;1-5(2)6(3)4/h12H,4-11H2,1-3H3;5-6H,1-4H3 |
| InChIKey | WLXFLKHUGPIYIE-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.52 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutane;3-methylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane;3-methylundecane?
The IUPAC name of 2,3-dimethylbutane;3-methylundecane (CID 173307544) is 2,3-dimethylbutane;3-methylundecane.
What is the SMILES notation for 2,3-dimethylbutane;3-methylundecane?
The canonical SMILES for 2,3-dimethylbutane;3-methylundecane is CC(C)C(C)C.CCCCCCCCC(C)CC.
What is the InChIKey of 2,3-dimethylbutane;3-methylundecane?
The InChIKey is WLXFLKHUGPIYIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26.C6H14/c1-4-6-7-8-9-10-11-12(3)5-2;1-5(2)6(3)4/h12H,4-11H2,1-3H3;5-6H,1-4H3.
What are the key properties of 2,3-dimethylbutane;3-methylundecane?
2,3-dimethylbutane;3-methylundecane has a molecular weight of 256.52 g/mol, XLogP of 7.08, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane;3-methylundecane is sourced from PubChem (CID 173307544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).