About 5-azido-4,4-dimethylhexan-3-one
5-azido-4,4-dimethylhexan-3-one (PubChem CID 118297127) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 5-azido-4,4-dimethylhexan-3-one.
Molecular Properties
| Compound Name | 5-azido-4,4-dimethylhexan-3-one |
| PubChem CID | 118297127 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 5-azido-4,4-dimethylhexan-3-one |
| SMILES | CCC(=O)C(C)(C)C(C)N=[N+]=[N-] |
| InChI | InChI=1S/C8H15N3O/c1-5-7(12)8(3,4)6(2)10-11-9/h6H,5H2,1-4H3 |
| InChIKey | YCNZMITYIKNBKD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-4,4-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-4,4-dimethylhexan-3-one?
The IUPAC name of 5-azido-4,4-dimethylhexan-3-one (CID 118297127) is 5-azido-4,4-dimethylhexan-3-one.
What is the SMILES notation for 5-azido-4,4-dimethylhexan-3-one?
The canonical SMILES for 5-azido-4,4-dimethylhexan-3-one is CCC(=O)C(C)(C)C(C)N=[N+]=[N-].
What is the InChIKey of 5-azido-4,4-dimethylhexan-3-one?
The InChIKey is YCNZMITYIKNBKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-5-7(12)8(3,4)6(2)10-11-9/h6H,5H2,1-4H3.
What are the key properties of 5-azido-4,4-dimethylhexan-3-one?
5-azido-4,4-dimethylhexan-3-one has a molecular weight of 169.23 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-4,4-dimethylhexan-3-one is sourced from PubChem (CID 118297127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).