C12H10BrN5 — CID 113292704
5-(6-bromonaphthalen-2-yl)-1,2,4-triazole-3,4-diamine (PubChem CID 113292704) has the molecular formula C12H10BrN5 and a molecular weight of 304.15 g/mol. Its IUPAC name is 5-(6-bromonaphthalen-2-yl)-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-(6-bromonaphthalen-2-yl)-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 113292704 |
| Molecular Formula | C12H10BrN5 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 5-(6-bromonaphthalen-2-yl)-1,2,4-triazole-3,4-diamine |
| SMILES | Nc1nnc(-c2ccc3cc(Br)ccc3c2)n1N |
| InChI | InChI=1S/C12H10BrN5/c13-10-4-3-7-5-9(2-1-8(7)6-10)11-16-17-12(14)18(11)15/h1-6H,15H2,(H2,14,17) |
| InChIKey | FQDFHMYRVHHMHK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |