C53H38N6 — CID 59096363
3-[4-[[4-(4,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-diphenylmethyl]phenyl]-4,5-diphenyl-1,2,4-triazole (PubChem CID 59096363) has the molecular formula C53H38N6 and a molecular weight of 758.93 g/mol. Its IUPAC name is 3-[4-[[4-(4,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-diphenylmethyl]phenyl]-4,5-diphenyl-1,2,4-triazole.
| Compound Name | 3-[4-[[4-(4,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-diphenylmethyl]phenyl]-4,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 59096363 |
| Molecular Formula | C53H38N6 |
| Molecular Weight | 758.93 g/mol |
| Exact Mass | 758.32 |
| IUPAC Name | 3-[4-[[4-(4,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-diphenylmethyl]phenyl]-4,5-diphenyl-1,2,4-triazole |
| SMILES | c1ccc(-c2nnc(-c3ccc(C(c4ccccc4)(c4ccccc4)c4ccc(-c5nnc(-c6ccccc6)n5-c5ccccc5)cc4)cc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C53H38N6/c1-7-19-39(20-8-1)49-54-56-51(58(49)47-27-15-5-16-28-47)41-31-35-45(36-32-41)53(43-23-11-3-12-24-43,44-25-13-4-14-26-44)46-37-33-42(34-38-46)52-57-55-50(40-21-9-2-10-22-40)59(52)48-29-17-6-18-30-48/h1-38H |
| InChIKey | IQGBWOCWJXMSQV-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.93 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|