C39H27N5O4 — CID 141475132
3,5-bis(4-nitrophenyl)-4-(4-tritylphenyl)-1,2,4-triazole (PubChem CID 141475132) has the molecular formula C39H27N5O4 and a molecular weight of 629.68 g/mol. Its IUPAC name is 3,5-bis(4-nitrophenyl)-4-(4-tritylphenyl)-1,2,4-triazole.
| Compound Name | 3,5-bis(4-nitrophenyl)-4-(4-tritylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 141475132 |
| Molecular Formula | C39H27N5O4 |
| Molecular Weight | 629.68 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | 3,5-bis(4-nitrophenyl)-4-(4-tritylphenyl)-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc(-c3ccc([N+](=O)[O-])cc3)n2-c2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C39H27N5O4/c45-43(46)35-22-16-28(17-23-35)37-40-41-38(29-18-24-36(25-19-29)44(47)48)42(37)34-26-20-33(21-27-34)39(30-10-4-1-5-11-30,31-12-6-2-7-13-31)32-14-8-3-9-15-32/h1-27H |
| InChIKey | VNGXYVIHSCPNPD-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.68 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|