C20H14BrN5O2 — CID 139221830
N-(4-bromophenyl)-4-(4-nitrophenyl)-5-phenyl-1,2,4-triazol-3-amine (PubChem CID 139221830) has the molecular formula C20H14BrN5O2 and a molecular weight of 436.27 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(4-nitrophenyl)-5-phenyl-1,2,4-triazol-3-amine.
| Compound Name | N-(4-bromophenyl)-4-(4-nitrophenyl)-5-phenyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 139221830 |
| Molecular Formula | C20H14BrN5O2 |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | N-(4-bromophenyl)-4-(4-nitrophenyl)-5-phenyl-1,2,4-triazol-3-amine |
| SMILES | O=[N+]([O-])c1ccc(-n2c(Nc3ccc(Br)cc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14BrN5O2/c21-15-6-8-16(9-7-15)22-20-24-23-19(14-4-2-1-3-5-14)25(20)17-10-12-18(13-11-17)26(27)28/h1-13H,(H,22,24) |
| InChIKey | RXAKXWNKZKTLOC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|