C19H21N5O2 — CID 86065633
4-butyl-N-(4-methylphenyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-amine (PubChem CID 86065633) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-butyl-N-(4-methylphenyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-amine.
| Compound Name | 4-butyl-N-(4-methylphenyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 86065633 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-butyl-N-(4-methylphenyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-amine |
| SMILES | CCCCn1c(Nc2ccc(C)cc2)nnc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21N5O2/c1-3-4-13-23-18(15-7-11-17(12-8-15)24(25)26)21-22-19(23)20-16-9-5-14(2)6-10-16/h5-12H,3-4,13H2,1-2H3,(H,20,22) |
| InChIKey | HNNDXRBUTVZZBG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|