C25H21N3O2 — CID 71530455
3-butyl-2-(4-nitrophenyl)phenanthro[9,10-d]imidazole (PubChem CID 71530455) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-butyl-2-(4-nitrophenyl)phenanthro[9,10-d]imidazole.
| Compound Name | 3-butyl-2-(4-nitrophenyl)phenanthro[9,10-d]imidazole |
|---|---|
| PubChem CID | 71530455 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-butyl-2-(4-nitrophenyl)phenanthro[9,10-d]imidazole |
| SMILES | CCCCn1c(-c2ccc([N+](=O)[O-])cc2)nc2c3ccccc3c3ccccc3c21 |
| InChI | InChI=1S/C25H21N3O2/c1-2-3-16-27-24-22-11-7-5-9-20(22)19-8-4-6-10-21(19)23(24)26-25(27)17-12-14-18(15-13-17)28(29)30/h4-15H,2-3,16H2,1H3 |
| InChIKey | IRQSPJNBGXMLRX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|