C21H21N5O2 — CID 90146175
2-butyl-1-[(4-nitrophenyl)methyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 90146175) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-butyl-1-[(4-nitrophenyl)methyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-1-[(4-nitrophenyl)methyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 90146175 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-butyl-1-[(4-nitrophenyl)methyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N5O2/c1-2-3-8-18-24-19-20(16-6-4-5-7-17(16)23-21(19)22)25(18)13-14-9-11-15(12-10-14)26(27)28/h4-7,9-12H,2-3,8,13H2,1H3,(H2,22,23) |
| InChIKey | ASTWGLVPOWYADV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|