C22H14N6 — CID 71482704
5,8-diphenyl-3,4,6,7,9,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2,4,8,10,12,14-heptaene (PubChem CID 71482704) has the molecular formula C22H14N6 and a molecular weight of 362.40 g/mol. Its IUPAC name is 5,8-diphenyl-3,4,6,7,9,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2,4,8,10,12,14-heptaene.
| Compound Name | 5,8-diphenyl-3,4,6,7,9,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2,4,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 71482704 |
| Molecular Formula | C22H14N6 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 5,8-diphenyl-3,4,6,7,9,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2,4,8,10,12,14-heptaene |
| SMILES | c1ccc(-c2nnc3c4ccccc4c4nnc(-c5ccccc5)n4n23)cc1 |
| InChI | InChI=1S/C22H14N6/c1-3-9-15(10-4-1)19-23-25-21-17-13-7-8-14-18(17)22-26-24-20(28(22)27(19)21)16-11-5-2-6-12-16/h1-14H |
| InChIKey | HRBBFTXQFJBFLM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |