C24H23N3 — CID 140615503
3,4-bis(2,6-dimethylphenyl)-5-phenyl-1,2,4-triazole (PubChem CID 140615503) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 3,4-bis(2,6-dimethylphenyl)-5-phenyl-1,2,4-triazole.
| Compound Name | 3,4-bis(2,6-dimethylphenyl)-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 140615503 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3,4-bis(2,6-dimethylphenyl)-5-phenyl-1,2,4-triazole |
| SMILES | Cc1cccc(C)c1-c1nnc(-c2ccccc2)n1-c1c(C)cccc1C |
| InChI | InChI=1S/C24H23N3/c1-16-10-8-11-17(2)21(16)24-26-25-23(20-14-6-5-7-15-20)27(24)22-18(3)12-9-13-19(22)4/h5-15H,1-4H3 |
| InChIKey | VSADFFQOUKDGKI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |